On Target NPSR1_HUMAN 0.39719626/CHEMBL1801361
For the given ligand Cilostazol, we have found in our database that, being scored 0.39719626, the most similar ligand is CHEMBL1801361. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1801361 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCN(CC)C(=O)CCC1(c2ccc(Cl)cc2)c3c(OC)cccc3c4nccn14 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0003c102 41800208 2010030a 10810600 20081060 00002100 02000400 21081600 80300900 100818c0 08308008 40039840 07009866 00a00000 018200a1 020d200c 10000480 0e002080 00480000 00422201 80100100 38008710 a1005040 83500419 00002000 e0000001 00040100 50014080 06000384 0046480b 420c0800 00420600 |