On Target NK2R_HUMAN 0.39790577/CHEMBL443691
For the given ligand Cilostazol, we have found in our database that, being scored 0.39790577, the most similar ligand is CHEMBL443691. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL443691 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCCOc1cccc(c1)C(=O)NC2(CCCC2)C(=O)N[C@H](Cc3ccccc3)C(=O)NCC4CCN(CC5CCOCC5)CC4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04018000 45003a08 20100108 04010700 80181000 02000000 02000000 2200100c 00200880 000908c0 08300000 5003b000 0680880a 00002081 91004401 200c3008 00000000 02000000 00482008 00020201 00000120 38268610 01000003 8354801c 00000c00 c0000000 00000200 90000000 0c000300 0106000b a0044000 00002e00 |