On Target ADRB3_HUMAN 0.50555557/CHEMBL70399
For the given ligand Cilostazol, we have found in our database that, being scored 0.50555557, the most similar ligand is CHEMBL70399. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL70399 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1ccc(CCNC[C@@H](O)COc2ccc(O)c3NC(=O)CCc23)cc1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004002 c2000208 20100108 00010600 30001080 c6002040 06040000 00000200 00000890 000808c0 08380024 40009040 04808002 08100000 012a0041 000c6008 10248080 22008000 08800008 00022601 40100100 18200600 27002080 89408410 00000801 c1000000 201a0050 10801080 04008300 0006800b 00000400 22022640 |