On Target ADA2B_HUMAN 0.41714287/CHEMBL1201216
For the given ligand Cilostazol, we have found in our database that, being scored 0.41714287, the most similar ligand is CHEMBL1201216. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1201216 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Cc1ccccc1N2CCN(CCc3nnc4CCCCn34)CC2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004002 01000008 40101120 04010600 01080000 00000044 05800000 20000200 00000100 10041ac0 00208104 420188c0 00000006 00802000 01020040 0008200c 80248000 0e000000 08400008 00240201 40300c00 3a402010 25000021 02500412 00001000 c0000200 10000000 10011080 08088004 00064000 80000080 20000200 |