On Target 5HT1F_HUMAN 0.41666666/CHEMBL3616488
For the given ligand Cilostazol, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL3616488. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3616488 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1c(NC(=O)c2ccc(F)cc2)cccc1C(=O)C3CCN(C)CC3 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00024002 01000808 6010010a 02010600 84001000 00020010 02000000 22001200 00500800 000808d0 08380004 5001d040 04008802 00301800 01200041 10006408 00040000 06000100 08000000 00120201 44100100 18028600 20012000 00508414 00040000 c0000000 20000840 90000081 20408300 0006c003 80040000 00800600 |