On Target AA2AR_HUMAN 0.420765/CHEMBL539454
For the given ligand Cilostazol, we have found in our database that, being scored 0.420765, the most similar ligand is CHEMBL539454. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL539454 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCN(CCc1ccc(NC(=O)CCC(N)C(=O)NCCCCC(NC(=O)C(CCCCNC(=O)C)NC(=O)C)C(=O)N)cc1)C2CCc3c(O)cccc3C2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00034002 43003a08 20100102 44010600 20000020 c0002000 02000000 20000209 00200880 000a08c0 08380004 4083b040 0600801a 0030a001 80020040 02042008 00040200 02000000 08002000 00020201 40100100 38240630 20006003 83500018 00000000 80000001 00000000 10000080 0c008002 0006c00b 20004000 00002600 |