On Target DRD5_HUMAN 0.43203884/CHEMBL3577346
For the given ligand Cilostazol, we have found in our database that, being scored 0.43203884, the most similar ligand is CHEMBL3577346. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3577346 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCCn1cc(CCCOc2ccc(cc2OC)C(=O)NCCCCN(CCC)[C@H]3CCc4c(O)cccc4C3)nn1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04000000 57001a18 6030010b 00a10718 00081020 c2000000 06042000 22001201 00200880 100808c0 08308000 40838840 0080ca86 00a02000 13014401 2a0ca00c 00000200 86000000 00482000 00060201 00020100 18268610 010050c0 8154801c 00200001 c2000001 00220000 90002000 04000306 0006c00b b0040000 0400a640 |