On Target HRH4_HUMAN 0.36571428/CHEMBL1688972
For the given ligand Cilostazol, we have found in our database that, being scored 0.36571428, the most similar ligand is CHEMBL1688972. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1688972 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | C(Cc1c[nH]cn1)Cn2cc(CCC3CCCCC3)nn2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00000002 53000018 60200003 00800418 04080340 40000000 04002000 00000200 00500900 10080080 20008000 40010840 00000284 00902800 02030000 080c200c 00000000 86000000 02402008 40040001 20120400 18000010 21001000 00500014 00240000 01000200 00000000 10002180 00000006 00464008 50020000 24008c00 |