On Target BKRB2_HUMAN 0.4/CHEMBL26908
For the given ligand Cilostazol, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL26908. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL26908 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CN(C(=O)CCc1ccc(C(=O)c2ccc(cc2)C#N)n1C)c3ccc(C)c(COc4cccc5ccc(C)nc45)c3C |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0400400a 00004e08 60105108 50010600 24041021 04086044 02800020 01221000 00000900 008808d0 08388024 50859800 04808802 08718000 01020441 020c008e 00448000 06000005 08a10018 80020001 60100100 18068628 20802400 80c4941c 00041c00 e0082000 00000250 50001180 004a8285 0086044b c0040280 20000600 |