On Target NPY2R_HUMAN 0.7303371/CHEMBL1288048
For the given ligand fentanyl, we have found in our database that, being scored 0.7303371, the most similar ligand is CHEMBL1288048. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL1288048 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3.C | CC(C)(C(=O)Nc1ccc(N2CCC(CC2)N3CCCCC3)c(Cl)c1)c4ccccc4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 0000c002 01001400 00100100 01010600 20000000 00002000 08000000 28000000 00000000 000809e0 08280004 50019800 03008006 00100001 40020040 00000000 00040000 0a000000 08000000 00004201 60100000 18240700 20002000 81510011 00002000 80000400 00000000 10000080 04008000 00060013 00002000 00022600 |