On Target MC4R_HUMAN 0.5470086/CHEMBL379051
For the given ligand fentanyl, we have found in our database that, being scored 0.5470086, the most similar ligand is CHEMBL379051. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL379051 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3.C | CC(C)CC(CC(C)C)N1CCN(CC1)C(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)CC3Cc4ccccc4N3 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 0001c002 01003600 00100102 04010600 20000000 00000040 01000000 2000000c 00100880 000809e0 08300004 5001b800 0e008026 00202000 80020140 00040002 00040000 02000000 08002018 00000201 60100100 38200700 20000023 83500019 00002800 80000000 00040000 10001080 0c008000 0006001b 20024000 20422600 |