On Target CLTR1_HUMAN 0.39473686/CHEMBL423333
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.39473686, the most similar ligand is CHEMBL423333. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL423333 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | O=C(NCCc1ccc(cc1)c2nn[nH]n2)c3ccc4ccc(OCc5ccc6ccccc6n5)cc4c3 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 04000002 00001818 62124108 10010600 00041020 00004048 02000000 02081004 00000380 00080840 08208004 40008800 00808882 00410000 01020441 020c200c 04008000 02800800 00200000 00020200 40060100 18228628 a0808002 81c0511c 00000000 c0202000 10000040 80000000 04000304 00060003 e0040200 08000600 |