On Target NPY5R_HUMAN 0.43085107/CHEMBL42437
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.43085107, the most similar ligand is CHEMBL42437. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL42437 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Fc1ccc2C(Cc3cccnc3)C(CCc2c1)NC(=O)[C@@H]4CC[C@@H](CNC(=O)c5ccccc5)CC4 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00010002 01005a00 00104102 02810610 00041320 00000012 00002000 22001005 00400880 000828c0 08300004 50819000 0400880a 00201800 00000400 02040004 00000200 02000084 02202400 00100201 40000100 18368610 20c04000 8950001c 00040000 c0000001 88000000 90000001 04500102 0006800b a0060000 00002700 |