On Target CCR4_HUMAN 0.19672132/CHEMBL397845
For the given ligand Ibuprofen, we have found in our database that, being scored 0.19672132, the most similar ligand is CHEMBL397845. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL397845 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CN(C1CCN(CCCc2ccccc2)CC1)C(=O)[C@@H]3CCCN3S(=O)(=O)c4ccc5ccccc5c4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00010090 01801600 01100100 05b10600 00088000 00000010 00020000 20000000 00000800 004809e0 08302000 7001b000 06008012 00002001 80600000 00048000 00002000 02000000 00600000 00006601 80040100 38080629 00000001 3a500038 02000000 80000004 00000000 1000000c 08000400 2006001b 00004002 00012670 |