On Target ADRB3_HUMAN 0.42666668/CHEMBL408694
For the given ligand Ibuprofen, we have found in our database that, being scored 0.42666668, the most similar ligand is CHEMBL408694. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL408694 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | O[C@@H](CNCCc1ccc(cc1)c2ccc(CC(=O)O)cc2)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 0000a000 14000000 00100100 00010600 000000c0 00004000 04000000 00000000 00000180 00080840 08200000 40009800 03008006 00000000 c00c0000 00080008 18020000 02000000 04000000 10000200 00000000 18200b20 13000000 81480010 00002000 80000000 00000000 00000040 04004000 00060002 40002000 00022600 |