On Target TSHR_HUMAN 0.24324325/CHEMBL3969230
For the given ligand Ibuprofen, we have found in our database that, being scored 0.24324325, the most similar ligand is CHEMBL3969230. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL3969230 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC(=O)N1c2ccc(NC(=O)CCc3cccc(c3)C(F)(F)F)cc2C(C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 08004002 01011200 40100102 00010600 24000021 00082040 01000400 21000000 00400800 000808d0 08380024 40009002 04008002 01300800 00020040 000c0008 00048000 02000001 08000008 00000201 44100100 18040600 21002000 00400018 00040800 a1000000 00000010 d0001080 00488080 0006000b 00100080 20000600 |