On Target HRH1_HUMAN 0.54545456/CHEMBL914
For the given ligand Ibuprofen, we have found in our database that, being scored 0.54545456, the most similar ligand is CHEMBL914. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL914 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC(C)(C(=O)O)c1ccc(cc1)C(O)CCCN2CCC(CC2)C(O)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 01000000 00100102 00050600 00100040 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 01008002 00200000 40040000 00080008 08000000 02000000 00400000 00000201 00000100 18000a20 01000000 00500010 00000000 a0000000 00000000 50000000 00000080 00060002 40002000 00002e00 |