On Target MC5R_HUMAN 0.26168224/CHEMBL185862
For the given ligand Ibuprofen, we have found in our database that, being scored 0.26168224, the most similar ligand is CHEMBL185862. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL185862 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | NCCC(=O)N[C@H](Cc1ccc(Cl)cc1Cl)C(=O)N2CCN(CC2)C3(CNC(=O)Cc4ccccc4)CCCCC3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00008000 01003600 00110100 04010600 00000000 00000020 00000000 2000000c 00000880 000809c0 08300000 4001b980 0f00a026 00002400 c0000000 00040001 00000000 02000000 02002008 00000201 00000500 38240710 00000023 83500018 00002800 80000200 00040000 10000000 0c000000 0006001b 20026000 00022600 |