On Target GRM5_HUMAN 0.44354838/CHEMBL1682820
For the given ligand THC, we have found in our database that, being scored 0.44354838, the most similar ligand is CHEMBL1682820. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL1682820 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | O=C1CCOc2cc(COc3ccccc3)ccc12 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000000 48000818 20000108 40050300 00001000 02224000 02000000 00000200 00000900 00080848 08100000 40009860 10808002 00010080 11000005 02082008 00000000 02008000 00480000 00020201 00000100 08020220 01000060 00c01014 00000000 c0002000 00000800 00000000 00000300 00020002 c0000000 00000400 |