On Target CXCR1_HUMAN 0.1305842/CHEMBL3906175
For the given ligand Biloblide D, we have found in our database that, being scored 0.1305842, the most similar ligand is CHEMBL3906175. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL3906175 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CCOC(=O)[C@@H]1CCCN1C(=O)c2cccc(NC3=C(NC(C4CCCS4)c5oc(C)cc5)C(=O)C3=O)c2F |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 1041c08a c3205800 e0180302 8a112700 24090081 08002818 800002a0 222d1500 05e04d40 071b48d0 00380034 5043b880 ce098c5f 41241008 800a9468 100811c8 16874601 22008c00 0863aa30 26000241 40100da0 18168e00 33000300 2658001c 04841430 c0000280 04d04010 9c0c0581 60588302 a006c023 a4045024 43012600 |