On Target 5HT1B_HUMAN 0.22695035/CHEMBL321190
For the given ligand Biloblide D, we have found in our database that, being scored 0.22695035, the most similar ligand is CHEMBL321190. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL321190 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CCCCCCCCC(=O)Oc1ccc2[nH]cc(CCN(C)C)c2c1 |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 04010002 01000808 20100108 41010710 000c1000 02000000 060c2000 00000000 00400000 00090840 08200004 40009000 1480880e 00c00000 11010041 000c200c 00820000 02000000 00602400 00020001 40000000 18208a08 31800000 91400010 00042000 80000000 08120000 00000000 04000200 00060002 00060200 10000620 |