On Target OPRD_HUMAN 0.3607595/CHEMBL1790709
For the given ligand Biloblide D, we have found in our database that, being scored 0.3607595, the most similar ligand is CHEMBL1790709. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL1790709 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc(O)cc2)[C@@H](C)O)C(=O)N[C@@H](CO[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@H]3O)C(=O)N |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 00010040 01007208 20100100 84010700 803c00c0 00200000 02003800 2800000c 00200880 010808e0 08300000 4001b000 16008002 02882001 80181008 002f9008 10a00040 02000000 11c0a008 00020201 00100120 38240600 17000083 8b500018 10000c01 80000000 00920000 34000021 0c000202 0006000b 20e04000 00002600 |