On Target EDNRA_HUMAN 0.2919708/CHEMBL64424

For the given ligand Ginkgo B, we have found in our database that, being scored 0.2919708, the most similar ligand is CHEMBL64424. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL64424 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O COc1ccc(CC2C(C(=O)O[C@@]2(O)c3ccc(OC)cc3)c4ccc(Cl)c(Cl)c4)cc1
2d depiction of Ginkgo B 2d depiction of CHEMBL64424
3d depiction of Ginkgo B 3d depiction of CHEMBL64424
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00058040 05000008 2000010a 00010b00 00281050 00004000 06040800 00000040 00000900 00080860 08100000 40009800 07008026 00210000 c10c0001 022a1008 08820020 02000000 04400000 00020001 00010120 08000b20 01000040 00540010 00002400 80102000 005e0000 20000000 00000200 00020002 40202000 02420400