On Target HRH2_HUMAN 0.1904762/CHEMBL1626

For the given ligand Ginkgo B, we have found in our database that, being scored 0.1904762, the most similar ligand is CHEMBL1626. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1626 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CN1CCC[C@@H]1CCO[C@](C)(c2ccccc2)c3ccc(Cl)cc3
2d depiction of Ginkgo B 2d depiction of CHEMBL1626
3d depiction of Ginkgo B 3d depiction of CHEMBL1626
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00008000 01000000 00100100 00010700 00080010 00004010 00000000 01000000 00000100 000808c0 08200000 40018800 020000a6 00890000 00000000 02081008 00a00000 02000000 00c02000 00000201 00000020 18000130 01000080 00500010 00002401 a0002000 000c0000 50000000 00000280 00060002 40000000 02022600