On Target ADRB1_HUMAN 0.25384617/CHEMBL1085395

For the given ligand Ginkgo B, we have found in our database that, being scored 0.25384617, the most similar ligand is CHEMBL1085395. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1085395 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc2ccccc2
2d depiction of Ginkgo B 2d depiction of CHEMBL1085395
3d depiction of Ginkgo B 3d depiction of CHEMBL1085395
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00000000 01000008 a0100100 00010700 00081091 00004000 02000000 20000840 00002180 000808c0 a8200000 40018000 00008002 00810000 00080000 0208b008 10800000 02000000 00402000 40020201 00000020 18200a30 07000000 89500010 00000400 80002000 005a0000 10000020 04000200 00060002 40000000 00002600