On Target DRD1_HUMAN 0.19463088/CHEMBL85409
For the given ligand Ginkgo B, we have found in our database that, being scored 0.19463088, the most similar ligand is CHEMBL85409. Check out the elaboration below.
| Ginkgo B (Given Ligand) | CHEMBL85409 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | NC[C@@H]1OC(CC2CCCC2)Cc3c(O)c(O)ccc13 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00000000 4b000008 20010502 80010700 00080071 c0004002 02100000 00000241 00000900 00080848 08100000 40808940 00000002 00a10000 00041020 0208b008 08800000 02000000 04402002 00020201 00010520 18000020 03004000 81400010 10000400 80002201 005a0000 00000000 04000203 01064802 40020000 02000400 |