On Target NPFF1_HUMAN 0.17880794/CHEMBL1672379

For the given ligand Ginkgo B, we have found in our database that, being scored 0.17880794, the most similar ligand is CHEMBL1672379. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1672379 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CC(C)C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)O
2d depiction of Ginkgo B 2d depiction of CHEMBL1672379
3d depiction of Ginkgo B 3d depiction of CHEMBL1672379
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00030000 01007000 00100100 04010e00 00000080 00000010 00000000 2000200c 00200a80 000a08c2 08300000 4003b000 16009012 00002001 80180000 00180008 10000000 02000000 00c00008 00000201 00000100 38250e20 030000c3 83500018 00000801 80000000 40000000 10000000 0c000010 00060003 a0084000 00802600