On Target OPRX_HUMAN 0.24338624/CHEMBL3326232

For the given ligand Ginkgo B, we have found in our database that, being scored 0.24338624, the most similar ligand is CHEMBL3326232. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL3326232 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CN[C@@]1(CC[C@]2(CC1)OCCc3c2[nH]c4ccccc34)c5ccccc5.OC(=O)CC(O)(CC(=O)O)C(=O)O
2d depiction of Ginkgo B 2d depiction of CHEMBL3326232
3d depiction of Ginkgo B 3d depiction of CHEMBL3326232
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 0005004a 01004800 02100502 50010710 003c1070 00004002 01002000 02001041 00500b00 000a28c0 08308004 4081d800 14008820 02e18000 000e0060 020c100c 18808000 06800004 0760240a 00400001 40310120 18008a78 a5805002 80500110 00042400 80002201 08080200 90000080 00000307 00860c02 40060200 20000e20