On Target GRM4_HUMAN 0.192/CHEMBL578988

For the given ligand Ginkgo B, we have found in our database that, being scored 0.192, the most similar ligand is CHEMBL578988. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL578988 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O OC(=O)[C@@H]1CCCC[C@@H]1C(=O)Nc2cc(Cl)cc(Cl)c2
2d depiction of Ginkgo B 2d depiction of CHEMBL578988
3d depiction of Ginkgo B 3d depiction of CHEMBL578988
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 0007c002 01000000 00100000 01000600 20180000 00002020 08000000 00000000 00000000 000008c0 00280004 40019800 0600800c 00900401 00020040 00080008 00040000 00000000 0a402000 00004001 40100000 18000f10 21002000 00100010 00002000 00000000 00000000 10000080 00008002 00060001 00020000 00820a00