On Target MC5R_HUMAN 0.2195122/CHEMBL1221512
For the given ligand Ginkgo B, we have found in our database that, being scored 0.2195122, the most similar ligand is CHEMBL1221512. Check out the elaboration below.
| Ginkgo B (Given Ligand) | CHEMBL1221512 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00000040 05005200 00300100 80110740 000800c0 02002200 00000000 20000040 84000800 000848c0 08302000 4008f000 06018002 04040002 803c1008 180c1008 1c821000 82000000 04400008 00000201 40010120 38000e03 13000301 0244001c 38000c00 80000000 00800000 10000001 08000200 0006002b 20004000 03012620 |