On Target CXCR1_HUMAN 0.14285715/CHEMBL139
For the given ligand Ginkgo A, we have found in our database that, being scored 0.14285715, the most similar ligand is CHEMBL139. Check out the elaboration below.
| Ginkgo A (Given Ligand) | CHEMBL139 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H]([H])[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | OC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 |