On Target CXCR2_HUMAN 0.23113208/CHEMBL272105
For the given ligand D9-1, we have found in our database that, being scored 0.23113208, the most similar ligand is CHEMBL272105. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL272105 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | COC(=O)C1=Nc2c(N[C@H](C)CO)nc(SCc3cccc(F)c3F)nc2NC1=O |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0001002a 01809900 02183520 1a192631 080090c2 0800c010 00008104 00001900 16420300 000068e0 0d280004 50009100 04009900 40151000 00ae0001 100c000d 0c069208 06804100 80410020 40200000 80140480 18048a40 a3804044 00e8011c 00040002 d1108000 d8008408 000000ad 0408420c 00468801 c0001000 000122c0 |