On Target MC4R_HUMAN 0.2204301/CHEMBL578944
For the given ligand MM-24, we have found in our database that, being scored 0.2204301, the most similar ligand is CHEMBL578944. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL578944 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | [Br-].CCC(C)(C)c1ccc(OCCCC[n+]2cccc(C)c2C)c(c1)C(C)(C)CC |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04000002 00000008 20104108 10010710 00141021 82000000 02040000 00000200 00000800 000808c0 08100004 40018040 00800802 00200000 11020001 020c200c 00000000 a2008004 08600000 00020001 40000100 18008010 21800000 00500410 00040000 c0000000 08120240 10800000 00400304 00060042 00000008 00000400 |