On Target MSHR_HUMAN 0.2/CHEMBL1682208
For the given ligand MM-24, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL1682208. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1682208 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COCC(=O)N[C@H]1Cc2cc3COCOc3c(Cc4ccc(Oc5cccc(CN(CCCN6CCN(CCCN)CC6)C1=O)c5)cc4)c2 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 00000000 44803608 20100108 04010600 08001081 00004800 02040000 23001a0c 00200980 000909e0 6c300000 4000f210 06008802 00012002 01181401 022c2008 10000800 82000000 00082008 40020301 80440100 38288620 13000021 83448018 00000800 e0402000 00120000 f4a00001 0d000380 0006001b 62044404 00012608 |