On Target ADRB2_HUMAN 0.13402061/CHEMBL1569630
For the given ligand ZJH-P, we have found in our database that, being scored 0.13402061, the most similar ligand is CHEMBL1569630. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1569630 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CC(=CCC(C)(C)C1OCCN1C(=O)c2ccccc2)C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000008 80405800 00100100 80010700 00000080 00000000 00020000 22001400 10000200 001008c0 00200000 40008000 00028802 00000000 00081408 001a1008 10004000 02000000 00400800 00002201 00000020 18068610 13008000 0040003c 10000400 c0000002 10c00000 90200001 04000300 00060001 a4040000 00000200 |