On Target CCR4_HUMAN 0.14563107/CHEMBL1907216
For the given ligand ZJH-P, we have found in our database that, being scored 0.14563107, the most similar ligand is CHEMBL1907216. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1907216 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | Brc1ccc(OCc2ccccc2)c(CNCC3CCCO3)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 04004008 21008008 20100108 80010600 00081080 00004100 02000000 22001400 40000100 001008c0 08200000 c0018000 00800812 01010000 01081509 02082008 10000000 02008000 00400000 00020201 00000060 18008020 13008000 00d01010 10004400 c0002000 00420000 90000001 00000300 00060000 64040008 08000200 |