On Target OPRM_HUMAN 0.25/CHEMBL394695
For the given ligand ZJH-P, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL394695. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL394695 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC1(CCN(CC1)C(c2ccccc2)c3ccccc3)C4CCCCC4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000000 01000000 00100100 00010600 00080000 00000000 00000000 23001000 00000000 000808c0 08200000 50018000 00000802 00800000 00000400 00080008 00000000 02000000 02c02000 00000201 00000000 18008010 01000080 00500010 00000001 e0000000 00000000 d0000000 00000180 00060002 20060000 00000600 |