On Target NK1R_HUMAN 0.175/CHEMBL213726
For the given ligand ZJH-P, we have found in our database that, being scored 0.175, the most similar ligand is CHEMBL213726. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL213726 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC[C@@H]1CC[C@H](OCc2cc(cc(c2)C(F)(F)F)C(F)(F)F)[C@H]1c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000000 010c0000 00100102 00010300 00280051 00004000 00000400 00000040 00000900 00080850 08100000 40008002 00000000 03a10000 00040000 02081008 08800000 02000000 14402000 40000001 00010120 08000020 01000040 00400010 00000400 80002000 00080000 90000000 00000202 01020002 40120004 02000600 |