On Target EDNRA_HUMAN 0.34188035/CHEMBL315927
For the given ligand ttt, we have found in our database that, being scored 0.34188035, the most similar ligand is CHEMBL315927. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL315927 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(C)C[C@@H]1NC(=O)[C@H](NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc3cccc4ccccc34)NC1=O)C(C)C |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00070000 01003200 00100100 04010600 00100000 00000010 00000000 2000000c 00000880 000808c0 08300000 4001b000 0e008012 00002001 80000000 000c0008 00000000 02000001 00c00018 00000201 00000100 38340e28 01000083 83500018 00001801 80000000 00000000 10000000 0c000002 0006000b 20004000 00802e00 |