On Target V1AR_HUMAN 0.31092438/CHEMBL1807279
For the given ligand ttt, we have found in our database that, being scored 0.31092438, the most similar ligand is CHEMBL1807279. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1807279 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC1CCCC(C1)NC(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)Cc3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00008000 01003200 00100100 04010600 00080000 00000000 00000000 2000000c 00000880 000808c0 08300000 4001b800 07008026 01802000 c0000000 000c0008 00000000 02000000 02c02008 00000201 00000100 38340710 01000081 83500018 00002801 80000000 00040000 10000000 0c000000 0006000b 20006000 00022600 |