On Target ACM5_HUMAN 0.4329897/CHEMBL277642
For the given ligand ttt, we have found in our database that, being scored 0.4329897, the most similar ligand is CHEMBL277642. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL277642 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | C[C@H]1CCC[C@H](\C=C\[C@@H]2[C@H]3CCCC[C@@H]3C[C@H]4[C@@H]2[C@H](C)OC4=O)N1C |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00050050 81008000 00100100 80010700 00080000 00000000 00100000 20000402 00000000 00108088 00200000 50019000 0402810a 00810000 00080400 00081108 20820000 00000100 02402000 00002201 00000020 10000a10 01008000 00100010 00200400 00000000 00484000 90000000 00000200 00040002 24020000 02000200 |