On Target ADRB2_HUMAN 0.33333334/CHEMBL1459608
For the given ligand ttt, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1459608. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1459608 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CCCCC(=O)Nc1ccc(cc1)C(=O)N2CCCC(C2)C(=O)OCC |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00014002 01001800 00100100 80010700 20080000 00002000 00000000 22001000 00000000 000008c0 00280004 50019000 0c008812 01188000 00020440 00081008 00a60000 02000001 08c00010 00000201 40100020 18168e00 21002080 0050001c 00001401 c0000000 00000000 90000080 00008300 00060001 a0040000 00002200 |