On Target CCR1_HUMAN 0.4074074/CHEMBL3679652
For the given ligand ttt, we have found in our database that, being scored 0.4074074, the most similar ligand is CHEMBL3679652. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3679652 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC1(C)CN(CC[C@]1(O)c2ccc(Cl)cc2)C(=O)[C@H]3CCC[C@H]3NC(=O)[C@@H]4CC[C@H](O)C4 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00058000 01001600 00100100 00010600 00180000 00004000 00000000 20000000 00000900 000809e0 08300000 50019800 0e0080ae 01000000 00000000 000c0008 00000000 02000001 00c02010 00000201 00000100 181c0730 01000080 00500018 00003001 80000000 00040000 10000000 00000000 0106001b 40000000 00022e00 |