On Target TAAR1_HUMAN 0.48/CHEMBL1724146
For the given ligand ttt, we have found in our database that, being scored 0.48, the most similar ligand is CHEMBL1724146. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1724146 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(=C1C2CCC1C(C2C(=O)O)C(=O)NCCc3ccccc3)C |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00070000 81001000 00100100 00010600 00180000 00000000 00000000 20000404 10000080 001888c8 08200000 40019000 0402800a 00800000 00000400 00080008 00004000 02000000 02412000 02002201 00000000 18200e10 01008000 81500018 00000000 80000000 00404000 90000000 04000002 81060003 24020000 00802e00 |