On Target GRM7_HUMAN 0.25210086/CHEMBL432038
For the given ligand ttt, we have found in our database that, being scored 0.25210086, the most similar ligand is CHEMBL432038. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL432038 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | N[C@@](CC1c2ccccc2Oc3ccccc13)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 01000208 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a00 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 0006c00a 02020400 00400400 |