On Target CNR1_HUMAN 0.51282054/CHEMBL472661
For the given ligand ttt, we have found in our database that, being scored 0.51282054, the most similar ligand is CHEMBL472661. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL472661 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CCCCCCCC\C=C/CCCCCCCC(=O)N[C@@H]1C[C@@H]1O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010000 01005000 00100000 00000400 00000080 00000000 00000000 20000402 00000000 00100080 00200000 40011000 0402800a 01000000 00080400 00080008 10000000 00000000 00802000 00000201 00000000 10100610 03008080 00100018 00200001 00000000 00404000 90000000 00000000 00040001 24020000 00002200 |