On Target PTAFR_HUMAN 0.24806201/CHEMBL52693
For the given ligand ttt, we have found in our database that, being scored 0.24806201, the most similar ligand is CHEMBL52693. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL52693 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | O=C(CCCCC=C(c1ccccc1)c2ccccc2)NCCCCc3cccnc3 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010002 01005000 00104302 00810610 00041100 00000000 80002080 21000400 00500800 001808c0 08300004 40019000 0402880a 00200800 00000402 00040004 00000400 02000004 00202400 00000201 40000100 18048610 20808020 00500018 01040000 a0000000 08406000 d0000000 00400080 00060003 24000000 00002600 |