On Target NPY5R_HUMAN 0.2734375/CHEMBL3126039
For the given ligand ttt, we have found in our database that, being scored 0.2734375, the most similar ligand is CHEMBL3126039. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3126039 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | Fc1cc(F)cc(c1)c2cnc(NC(=O)[C@@H]3CC[C@@H](CC3)N4CCCC4=O)nc2 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030002 01001000 00180180 02010610 00000000 00004018 00002000 20100000 04000100 200128c0 00300004 d0019000 0400801a 00001000 00000800 800c0004 00020000 02004000 06402000 40a00201 00000000 1c040630 20800840 00500018 00040001 80080000 00000200 10000041 00014008 00468801 40021000 00802380 |