On Target AA2AR_HUMAN 0.24698795/CHEMBL2070508
For the given ligand ttt, we have found in our database that, being scored 0.24698795, the most similar ligand is CHEMBL2070508. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL2070508 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | Nc1ncnc2c1ncn2[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)C(=O)NC4CCCC4 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 0005000a 01c01800 80180000 88090620 001800e0 0000c000 00008c00 20000800 00400100 018000b0 0c20800c 4001d004 14009032 01880300 00081088 381fc00c 10200020 80000000 19c00000 80201201 80080020 10040670 378000c0 0c10001c 10000401 40080002 00000200 10000071 00000209 01460001 c0280000 00002ac0 |