On Target TSHR_HUMAN 0.21176471/CHEMBL3897841
For the given ligand ttt, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL3897841. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3897841 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(=O)N1CCC(C)(C2C=C(NC(=O)OC3CCCC3)C=CC12)c4ccccc4 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00400030 09449200 0a100102 00110700 480e0000 00300001 00180000 a0000414 00000e00 001808ca 08340040 54418220 00028102 00210100 00002400 001e010c 20830000 03000142 40412880 00000201 00008900 18040e10 41008000 0050021a 00000000 80003002 00484800 90240100 10000200 010e140b ac000000 42012600 |